Hesperidin (Hesperetin 7-rutinoside), a flavanone glycoside, is isolated from citrus fruits. Hesperidin has numerous biological properties, such as decreasing inflammatory mediators and exerting significant antioxidant effects. Hesperidin also exhibits antitumor and antiallergic activities.
For research use only. We do not sell to patients.
| Name | Hesperidin |
|---|---|
| Cat. No. | CS-5631 |
| CAS No. | 520-26-3 |
| MDL. | MFCD00075663 |
| Formula | C28H34O15 |
| M. Wt. | 610.56 |
| SMILES | OC1=C(OC)C=CC([C@@H]2CC(C3=C(C=C(O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)C=C3O)O2)=O)=C1 |
